Source code for schrodinger.livedesign.preprocessor

import argparse
import copy
import datetime
import enum
import json
import math
import re
from collections import defaultdict
from typing import Any
from typing import Callable
from typing import NamedTuple
from typing import Optional
from typing import Tuple

import decorator
import numpy as np
from rdkit import Chem
from rdkit import Geometry
from rdkit.Chem import SaltRemover
from rdkit.Chem import rdChemReactions
from rdkit.Chem import rdMolAlign
from rdkit.Chem import rdmolops
from rdkit.Chem.Descriptors import MolWt
# we can statically store the MolVS classes used in TAUTOMERIZE and NEUTRALIZE here
# so they are only created and initialized once:
from rdkit.Chem.MolStandardize import rdMolStandardize

from schrodinger import adapter
from schrodinger import structure
from schrodinger.infra import mm
from schrodinger.infra import structure as infrastructure
from schrodinger.job.driver_decorator import main_wrapper
from schrodinger.livedesign import convert
from schrodinger.livedesign import molhash
from schrodinger.thirdparty import rdkit_adapter
from schrodinger.utils import log

try:
    from schrodinger.application.epik import epik_tautomer_canonicalizer
except ImportError as e:
    epik_tautomer_canonicalizer = e

logger = log.get_output_logger(__file__)

uncharger = rdMolStandardize.Uncharger(canonicalOrder=True)

audit_changes_log = None

# string constants for mol props
ATOM_PROP_EXPLICIT_H = 'numExplicitHs'
ATOM_PROP_HAD_ATTCHPT = 'hadAttchPt'
ATOM_PROP_MOL_PARITY = 'molParity'
ATOM_PROP_ORIGINAL_INDEX = '_AtomOriginalIndex'
ATOM_PROP_REMOVE_DUMMY = 'removeDummy'
BOND_PROP_BOND_STEREO = "_MolFileBondStereo"
BOND_PROP_BOND_CONFIG = "_MolFileBondCfg"
BOND_PROP_BOND_TYPE = '_MolFileBondType'
MOL_PROP_ATTACHPT = "molAttchpt"
MOL_PROP_CHIRAL_FLAG = "_MolFileChiralFlag"
MOL_PROP_STEREO_DONE = "_StereochemDone"
MOL_PROP_UNKNOWN_STEREO = "_UnknownStereo"
LD_PROP_FORCE_COORDGEN = "b_ld_alwayscoordgen"
MOL_PROP_ON = 1
MOL_PROP_OFF = 0

_SANITIZE_OPS = Chem.SANITIZE_ALL ^ Chem.SANITIZE_PROPERTIES ^ Chem.SANITIZE_CLEANUP ^ Chem.SANITIZE_CLEANUPCHIRALITY ^ Chem.SANITIZE_FINDRADICALS

STD_DEFAULT_SALTS = (
    "[Cl,Br,I]",
    "[Li,Na,K,Ca,Mg]",
    "[O,N]",
    "[N](=O)(O)O",
    "[P](=O)(O)(O)O",
    "[P](F)(F)(F)(F)(F)F",
    "[S](=O)(=O)(O)O",
    "[CH3][S](=O)(=O)(O)",
    # p-Toluene sulfonate
    "c1cc([CH3])ccc1[S](=O)(=O)(O)",
    # Acetic acid
    "[CH3]C(=O)O",
    # TFA
    "FC(F)(F)C(=O)O",
    # Fumarate/Maleate
    "OC(=O)C=CC(=O)O",
    # Oxalate
    "OC(=O)C(=O)O",
    # Tartrate
    "OC(=O)C(O)C(O)C(=O)O",
    # Dicylcohexylammonium
    "C1CCCCC1[NH]C1CCCCC1",
)

STD_TRANSFORMATIONS = (
    # Pentavalent N
    "[#7+0;v5:1]=[#8+0:2]>>[#7+:1]-[#8-:2]",
    # Phosphonium Ylide
    "[#6:3][P-:1]([#6:4])([#6:5])[#6+:2]>>[#6:3][P-0:1]([#6:4])([#6:5])=[#6+0:2]",
    # Sulfon
    "[#6:3][S;X3+0:1]([#6:4])=[#8-0:2]>>[#6:3][S+:1]([#6:4])-[#8-:2]",
    # Phosphonic
    "[#6:3][P+:1]([#8;X2:4])([#8;X2:5])[#8-:2]>>[#6:3][P+0:1]([#8:4])([#8:5])=[#8-0:2]",
    # Sulfoxide
    "[#6:3][S+:1]([#6:4])([#8-:2])=[O:5]>>[#6:3][S+0:1]([#6:4])(=[#8-0:2])=[O:5]",
    # Azide
    "[#7;A;X2-:1][N;X2+:2]#[N;X1:3]>>[#7-0:1]=[N+:2]=[#7-:3]",
    # Diazo
    "[#6;X3-:1][N;X2+:2]#[N;X1:3]>>[#6-0;A:1]=[N+:2]=[#7-:3]",
)


[docs]class ExplicitHydrogens(enum.Enum): REMOVE_ALL = enum.auto() KEEP_WEDGED = enum.auto() ADD_ALL = enum.auto() AS_IS = enum.auto()
[docs]class GenerateCoordinates(enum.Enum): NONE = enum.auto() FULL = enum.auto() FULL_ALIGNED = enum.auto()
[docs]class DoubleBondStereoStandard(enum.Enum): NONE = enum.auto() CROSSED = enum.auto() WIGGLY = enum.auto()
[docs]class RingRepresentation(enum.Enum): KEKULE = enum.auto() AROMATIC = enum.auto()
[docs]class RemoveSGroupData(enum.Enum): NONE = enum.auto() ALL = enum.auto() DAT_ONLY = enum.auto()
[docs]class ChiralFlag0Meaning(enum.Enum): UNGROUPED_ARE_ABSOLUTE = enum.auto() # ABS UNGROUPED_ARE_RACEMIC = enum.auto() # AND UNGROUPED_ARE_RELATIVE = enum.auto() # OR
[docs]class PreprocessorOptions(NamedTuple): """ Options dictating preprocessor actions :cvar RESOLVE_AMBIGUOUS_TAUTOMERS: whether to guess tautomeric state for ambiguous input. if false, ambiguous input will fail with a kekulization error """ MAX_NUM_ATOMS: Optional[int] = None KEEP_ONLY_LARGEST_STRUCTURE: bool = True REMOVE_PROPERTIES: bool = False STRIP_SALTS: Tuple[str] = STD_DEFAULT_SALTS CLEAN_WEDGE_ORIENTATION: bool = True RESOLVE_AMBIGUOUS_TAUTOMERS: bool = False CHOOSE_CANONICAL_TAUTOMER: bool = False TRANSFORMATIONS: Tuple[str] = STD_TRANSFORMATIONS NEUTRALIZE: bool = True EXPLICIT_HYDROGENS: ExplicitHydrogens = ExplicitHydrogens.REMOVE_ALL GENERATE_COORDINATES: GenerateCoordinates = GenerateCoordinates.FULL_ALIGNED DOUBLE_BOND_STEREO_STANDARD: DoubleBondStereoStandard = DoubleBondStereoStandard.CROSSED CHIRAL_FLAG_0_MEANING: ChiralFlag0Meaning = ChiralFlag0Meaning.UNGROUPED_ARE_ABSOLUTE HEAVY_HYDROGEN_DT: bool = False RING_REPRESENTATION: RingRepresentation = RingRepresentation.KEKULE REMOVE_SGROUP_DATA: RemoveSGroupData = RemoveSGroupData.NONE CLEAR_INVALID_WEDGE_BONDS: bool = True STRIP_STEREO_ABSOLUTE_GROUP: bool = True STRIP_AND_GROUPS_ON_SINGLE_ATOM: bool = True @staticmethod def _updateConfig(config: dict): """ :param dict: configuration to validate/update deprecated options """ # Validate/fix deprecated options key = "CORE_SUITE_NEUTRALIZE" if config.get(key): raise KeyError(f"{key} is not supported") config.pop(key, None) key = "GENERATE_V3K_SDF" if config.get(key) is False: # aka v2000 raise KeyError(f"{key} is not supported") config.pop(key, None) key = "FORCE_ABSOLUTE_STEREOCHEMISTRY" value = config.get(key) if config.get(key): raise KeyError(f"{key} is not supported") config.pop(key, None) # Update deprecated option formats key = "STRIP_SALTS" value = config.get(key) if isinstance(value, dict): config[key] = value["SALTS"].split() if value["STRIP"] else [] key = "TRANSFORMATIONS" value = config.get(key) if value and isinstance(next(iter(value), None), dict): config[key] = [transform["STRUCTURE"] for transform in value] key = "CHIRAL_FLAG_TREATMENT" if config.get(key): raise KeyError(f"{key} is not supported, see CHIRAL_FLAG_0_MEANING") config.pop(key, None)
[docs] @staticmethod def fromConfig(config: dict): """ :param config: configuration from which to build options :raise KeyError: if an unknown key is present :raise ValueError: if an unknown value is present """ PreprocessorOptions._updateConfig(config) key_to_enum = { "EXPLICIT_HYDROGENS": ExplicitHydrogens, "GENERATE_COORDINATES": GenerateCoordinates, "DOUBLE_BOND_STEREO_STANDARD": DoubleBondStereoStandard, "RING_REPRESENTATION": RingRepresentation, "REMOVE_SGROUP_DATA": RemoveSGroupData, "CHIRAL_FLAG_0_MEANING": ChiralFlag0Meaning, } config = copy.deepcopy(config) for key, value in config.items(): if key in key_to_enum: try: config[key] = key_to_enum[key][value] except KeyError: raise ValueError(f"{key} does not support {value}") try: return PreprocessorOptions(**config) except TypeError as e: raise KeyError(e)
[docs] def toConfig(self) -> dict: config = self._asdict() for key, value in config.items(): if isinstance(value, enum.Enum): config[key] = value.name return config
[docs]def remove_invalid_config_options(config: dict) -> Tuple[str]: """ :param config: configuration from which to build options, from which all invalid keys and values will be stripped :return: tuple of errors encountered """ errors = [] for key, value in list(config.items()): try: PreprocessorOptions.fromConfig({key: value}) except (KeyError, ValueError) as exc: config.pop(key) errors.append(str(exc)) return tuple(errors)
[docs]@decorator.decorator def audit_changes(func: Callable, mol: Chem.rdchem.Mol, *args): """ When the global audit_changes_log is initialized, compares mol CXSMILES before and after the given function call, capturing information when the CXSMILES has been changed. :param func: transformation function :param mol: molecule to apply transformation to """ if audit_changes_log is None: return func(mol, *args) # Hack for functions that directly operate on sdf molblocks if isinstance(mol, (str, bytes)): pre_cxsmiles = Chem.MolToCXSmiles( Chem.MolFromMolBlock(mol, sanitize=False)) mol = func(mol, *args) post_cxsmiles = Chem.MolToCXSmiles( Chem.MolFromMolBlock(mol, sanitize=False)) else: pre_cxsmiles = Chem.MolToCXSmiles(mol) mol = func(mol, *args) post_cxsmiles = Chem.MolToCXSmiles(mol) if pre_cxsmiles != post_cxsmiles: changes = {} changes["timestamp"] = f"{datetime.datetime.now().ctime()}" changes["operation"] = f"{func.__name__}{args}" changes["structure"] = post_cxsmiles audit_changes_log.append(changes) return mol
[docs]def getprop(getter: Callable, value: str, default: Any = None) -> Any: try: return getter(value) except KeyError: return default
[docs]def atom_has_non_standard_query(atom) -> bool: """ Checks if the atom has a non-standard query feature like M which rdkit doesn't consider as a query :param atom: the atom to check :returns whether or not the atom has a non standard query feature """ return getprop(atom.GetProp, "molFileAlias") == "M"
[docs]def s_group_has_non_standard_query(s_group) -> bool: """ Checks if the s-group has a non-standard query feature like M which rdkit doesn't consider as a query :param s_group: the s-group to check :returns whether or not the s-group has a non standard query feature """ return getprop(s_group.GetProp, "LABEL") == "M"
[docs]def is_queryatom_exception(atom): """ Normally we raise an exception if query atoms are in the molecule to be preprocessed. This function returns True for query atoms which are allowed. :param atom: the atom to check :returns whether or not the atom is allowed in the preprocessor """ if not atom.HasQuery(): return True # "*" atoms from mol blocks: if atom.HasQuery() and atom.DescribeQuery().strip() == "AtomNull": return True for bond in atom.GetBonds(): if bond.HasProp("_MolFileBondAttach"): # this indicates that the atom is actually an attachment point, # which are allowed even though we don't accept other # features return True return False
[docs]def coords_all_zero(conf): """ Returns whether or not all atom positions in a conformer are zero """ ps = conf.GetPositions() return np.alltrue(np.abs(ps) < 1e-4)
[docs]@audit_changes def setup_mol(mol): """ Setup on a molecule that is always done regardless of configuration. :param mol: An unsanitized RDKit Mol :returns: A partially sanitized RDKit mol, ready for the standardizer. """ # Don't sanitize kekulization until after fixing pentavalent aromatic # nitrogens ops = _SANITIZE_OPS ^ Chem.SANITIZE_KEKULIZE Chem.SanitizeMol(mol, sanitizeOps=ops) mol.UpdatePropertyCache(strict=False) # For mols with all zero-coordinates we will prime chiral tags # from the atom parities and not recalculate them again. mol = assign_zero_coords_chirality(mol) assign_stereochemistry(mol) return mol
[docs]@audit_changes def check_kekulization(mol, options): if options.CHOOSE_CANONICAL_TAUTOMER or options.RESOLVE_AMBIGUOUS_TAUTOMERS: mol = add_hs_to_aromatic_nitrogen(mol) # do not attempt to sanitize with kekulization before # fixing! throwing a KekulizeException seems to leave # the bonds in a bad state (all single bonds) Chem.SanitizeMol(mol, sanitizeOps=_SANITIZE_OPS) return mol
def _detect_unkekulized_atoms(m): errs = Chem.DetectChemistryProblems(m, _SANITIZE_OPS) for err in errs: if err.GetType() == 'KekulizeException': return sorted(err.GetAtomIndices()) return None
[docs]def add_hs_to_aromatic_nitrogen(mol): """ Intended to be used with molecules which have kekulization failures due to aromatic system(s) containing Ns where the user hasn't provided the location of the implicit Hs in the system. This picks an arbitrary (but canonical) aromatic N to add an H to in each aromatic system. Returns the original mol if it can't fix it. """ Chem.GetSymmSSSR(mol) tm = Chem.Mol(mol) unkekulized_atoms = _detect_unkekulized_atoms(tm) while unkekulized_atoms: tm, new_unkekulized_atoms = _fix_ring_system(tm, unkekulized_atoms) if new_unkekulized_atoms == unkekulized_atoms: # got stuck, return the original return mol unkekulized_atoms = new_unkekulized_atoms return tm
def _fix_ring_system(m, unkekulized_atoms): m.UpdatePropertyCache(False) # we want to always generate the same result for the same molecule # Which result to return will cause arguments, yay, but we'll # prefer smaller rings, then use the canonical atom ranking to break ties ranks = Chem.CanonicalRankAtoms(m) ri = m.GetRingInfo() atoms_to_check = unkekulized_atoms[:] atoms_to_check.sort(key=lambda x: (ri.MinAtomRingSize(x), ranks[x])) while atoms_to_check: ai = atoms_to_check.pop(0) atom = m.GetAtomWithIdx(ai) if atom.GetAtomicNum() != 7: continue if atom.GetDegree() != 2 or atom.GetNumExplicitHs() != 0: continue tm = Chem.Mol(m) atom = tm.GetAtomWithIdx(ai) atom.SetNumExplicitHs(1) atom.SetNoImplicit(True) # did we fix something? new_unkekulized_atoms = _detect_unkekulized_atoms(tm) if new_unkekulized_atoms != unkekulized_atoms: return tm, new_unkekulized_atoms return m, unkekulized_atoms
[docs]def assign_zero_coords_chirality(mol): """ Molecules with all-zero coordinates need to have the "chirality tags" primed from the atom parity properties. Once these are in place, we remove the conformer, and leave the mol in a state equivalent to one that came from a SMILES input. """ try: conf = mol.GetConformer() except ValueError: pass else: if coords_all_zero(conf): Chem.AssignAtomChiralTagsFromMolParity(mol) mol.RemoveAllConformers() return mol
[docs]def assign_stereochemistry(mol): try: conf = mol.GetConformer() except ValueError: pass else: if not coords_all_zero(conf): # If we have all-zero coordinates, we don't care about # the 2D/3D flag (which is read, rather than checked) if conf.Is3D(): # If we have 3D coordinates, calculate both chirality # and stereo bonds from them. Chem.AssignStereochemistryFrom3D(mol) return else: # If we have 2D coordinates available, use them # to refresh stereo bond directions Chem.DetectBondStereoChemistry(mol, conf) # The general case, valid both no conformation and calculate # stereochemistry from parity, and stereo bonds from bond directions. Chem.AssignStereochemistry(mol)
[docs]def restore_attachment_points(mol): """ Convert back dummy atoms into attachment points. """ dummy_atom_idxs = [ at.GetIdx() for at in mol.GetAtoms() if at.HasProp(ATOM_PROP_REMOVE_DUMMY) ] if not dummy_atom_idxs: return mol mol = convert_dummies_to_attachment_points(mol, dummy_atom_idxs) mol = handle_aromatic_heteroatoms_with_attachment_points(mol) Chem.SanitizeMol(mol, sanitizeOps=_SANITIZE_OPS) # SanitizeMol() resets the "_StereoChemDone" flag. We want to # preserve it, since a stereo recalculation may remove some of the # features we have, like chiralities on attachment points and # also some cases of bond stereo (see SHARED-8011) mol.SetUnsignedProp(MOL_PROP_STEREO_DONE, MOL_PROP_ON, computed=True) return mol
[docs]def convert_dummies_to_attachment_points(mol, dummy_atom_idxs): """ Since using dummy atoms instead of attachment points causes issues when using jchem, redo the changes made to the mol. The chiral tags added in replace_attachment_points will still be preserved. """ edit_mol = Chem.RWMol(mol) for atom_idx in sorted(dummy_atom_idxs, reverse=True): edit_mol.RemoveAtom(atom_idx) # Add attachment points back for at in edit_mol.GetAtoms(): if at.HasProp(ATOM_PROP_HAD_ATTCHPT) and at.HasProp( ATOM_PROP_EXPLICIT_H): at.SetIntProp(MOL_PROP_ATTACHPT, at.GetIntProp(ATOM_PROP_HAD_ATTCHPT)) at.SetNumExplicitHs(at.GetIntProp(ATOM_PROP_EXPLICIT_H)) at.ClearProp(ATOM_PROP_HAD_ATTCHPT) at.ClearProp(ATOM_PROP_EXPLICIT_H) return Chem.Mol(edit_mol)
[docs]def replace_attachment_points(mol): """ Replace attachment points with dummy atoms to preserve chirality """ attch_pts = [ a.GetIdx() for a in mol.GetAtoms() if a.HasProp(MOL_PROP_ATTACHPT) ] if not attch_pts: return mol # Replace attachment points with dummy atoms edit_mol = Chem.RWMol(mol) for atom_idx in attch_pts: attchpt_type = edit_mol.GetAtomWithIdx(atom_idx).GetIntProp( MOL_PROP_ATTACHPT) edit_mol.GetAtomWithIdx(atom_idx).SetIntProp(ATOM_PROP_HAD_ATTCHPT, attchpt_type) num_attch_pts = 1 if attchpt_type == -1: # this atom has two attachment points num_attch_pts = 2 exp_hs = edit_mol.GetAtomWithIdx(atom_idx).GetNumExplicitHs() edit_mol.GetAtomWithIdx(atom_idx).SetIntProp(ATOM_PROP_EXPLICIT_H, exp_hs) for i in range(num_attch_pts): new_at = edit_mol.AddAtom(Chem.Atom(0)) edit_mol.AddBond(atom_idx, new_at, Chem.BondType.SINGLE) edit_mol.GetAtomWithIdx(new_at).SetIntProp(ATOM_PROP_REMOVE_DUMMY, 1) edit_mol.GetAtomWithIdx(atom_idx).ClearProp(MOL_PROP_ATTACHPT) if exp_hs: edit_mol.GetAtomWithIdx(atom_idx).SetNumExplicitHs( exp_hs - num_attch_pts) # Dummy atoms should be query atoms. This ensures the dummy atom is written # as '*' instead of 'R' params = rdmolops.AdjustQueryParameters.NoAdjustments() params.makeDummiesQueries = True edit_mol = rdmolops.AdjustQueryProperties(edit_mol, params) # Update atom chirality to reflect all wedged/dashed bonds # TODO: Instead of assigning chirality from mol parity (which may not be # included in the molblock), give new dummy atoms coordinates and # calculate chiral tags by assigning bond directions then using # Chem.AssignChiralTypesFromBondDirs() for atom_idx in attch_pts: for bnd in edit_mol.GetAtomWithIdx(atom_idx).GetBonds(): if bnd.HasProp(BOND_PROP_BOND_CONFIG): at1 = bnd.GetBeginAtom() if at1.GetChiralTag() != Chem.rdchem.ChiralType.CHI_UNSPECIFIED: # chiral tag is already set continue # This is not conceptually correct or consistent with how RDKit # assigns chirality from atom parity. We are using this # approach for now since the dummy atoms are added at an # arbitrary index and can't be used to correctly determine # chiral tags from atom parity (see SHARED-7956). if at1.HasProp(ATOM_PROP_MOL_PARITY): if at1.GetIntProp(ATOM_PROP_MOL_PARITY) == 1: at1.SetChiralTag( Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CCW) elif at1.GetIntProp(ATOM_PROP_MOL_PARITY) == 2: at1.SetChiralTag( Chem.rdchem.ChiralType.CHI_TETRAHEDRAL_CW) return Chem.Mol(edit_mol)
[docs]@audit_changes def correct_sgroup_coordinates(mol): """ If coordinates are generated, make sure the FIELDDISP property in the Sgroups are using relative coordinates. """ s_groups = Chem.GetMolSubstanceGroups(mol) Chem.ClearMolSubstanceGroups(mol) for s_group in s_groups: properties = s_group.GetPropsAsDict() if s_group.HasProp("FIELDDISP"): new_fielddisp = re.sub(r'[0-9\- .]*D[AR]([U ])', r' 0.0 0.0 DR\1', s_group.GetProp("FIELDDISP")) s_group.SetProp("FIELDDISP", new_fielddisp) Chem.AddMolSubstanceGroup(mol, s_group) return mol
[docs]def preprocess_molblock(molblock: str, config: Optional[dict] = None) -> str: """ Standardizes an MDL molblock :param molblock: input molblock :param config: dict specifying preprocessor options :return: standardized molblock """ mol = convert.sdf_to_rdkit(molblock) options = PreprocessorOptions.fromConfig(config) if config else None out_mol = preprocess(mol, options) return convert_to_molblock(out_mol, options)
[docs]@rdkit_adapter.suppress_rdkit_log() def preprocess(mol: Chem.rdchem.Mol, options: Optional[PreprocessorOptions] = None ) -> Chem.rdchem.Mol: """ Standardizes an RDKit mol :param mol: input mol :param options: preprocessor options :return: standardized mol """ options = options or PreprocessorOptions() assert_not_blinded(mol, max_num_atoms=options.MAX_NUM_ATOMS) mol = handle_v2000_coordinate_bonds(mol) assert_not_query(mol) # Temporarily replace attachment points with dummy atoms to preserve chirality. # The dummy atoms will be removed and attachment points re-added after all other # transformations have been completed. mol = replace_attachment_points(mol) mol = setup_mol(mol) mol = fix_pentavalent_aromatic_nitrogens(mol) mol = check_kekulization(mol, options) # grab the initial MDL chiral flag value initial_chiral_flag = getprop(mol.GetUnsignedProp, MOL_PROP_CHIRAL_FLAG, MOL_PROP_OFF) initial_stereo_groups = mol.GetStereoGroups() substance_groups = filter_sgroups(mol, options.REMOVE_SGROUP_DATA) if options.REMOVE_PROPERTIES: mol = remove_properties(mol) # This needs to happen before any transformations that might change any bond/atom indexes. original_bond_mapping = tag_mol_indexes(mol) # clarification as to why we're removing Hs when ADD_ALL is set: # if we are going to be adding Hs later anyway, we might as # well remove them now in order to simplify the rest of the process # # In order to maintain the current Hs, EXPLICIT_HYDROGENS should be # set to "AS_IS" if options.EXPLICIT_HYDROGENS is ExplicitHydrogens.KEEP_WEDGED: mol = remove_explicit_hydrogens(mol, substance_groups, keep_wedged=True) elif options.EXPLICIT_HYDROGENS in (ExplicitHydrogens.REMOVE_ALL, ExplicitHydrogens.ADD_ALL): mol = remove_explicit_hydrogens( mol, substance_groups, keep_wedged=False) elif options.EXPLICIT_HYDROGENS is ExplicitHydrogens.AS_IS: # keep hydrogens as is, don't touch! pass if options.STRIP_SALTS: mol = strip_salts(mol, salt_list=options.STRIP_SALTS) if options.KEEP_ONLY_LARGEST_STRUCTURE: mol = remove_fragments(mol, substance_groups) if options.NEUTRALIZE: mol = neutralize(mol, options.EXPLICIT_HYDROGENS is ExplicitHydrogens.AS_IS) # Both transformations and tautomerization can "move" double bonds, # so we need to recalculate stereo if they cause any changes. # Also, tautomerization might reverse some of the transformations # we did, so run that first. if options.CHOOSE_CANONICAL_TAUTOMER: mol = generate_canonical_tautomer(mol) mol = apply_transformations(mol, options.TRANSFORMATIONS) if options.EXPLICIT_HYDROGENS is ExplicitHydrogens.ADD_ALL: mol = add_explicit_hydrogens(mol) elif options.EXPLICIT_HYDROGENS is ExplicitHydrogens.KEEP_WEDGED and \ options.CLEAN_WEDGE_ORIENTATION: # if we are going to be setting the wedge orientation, we need # to add chiral Hs now, before coordinates are generated. Then # we set the bond wedging after generating coordinates mol = add_chiral_hs(mol) elif not options.CLEAN_WEDGE_ORIENTATION: mol = reapply_molblock_wedging(mol) # This should happen after all transformations that can alter # atom and bond indexes mol = update_mol_groups(mol, initial_stereo_groups, substance_groups, original_bond_mapping) if options.CLEAR_INVALID_WEDGE_BONDS: mol = clear_wedge_bonds_from_achiral_centers(mol) # Calculating the enhanced stereochemistry should happen # after clear_wedge_bonds_from_achiral_centers(), since it does # recalculate stereo, and we might find/remove some chiral centers mol = calculate_enhanced_stereo(mol, options.CHIRAL_FLAG_0_MEANING, initial_chiral_flag) if options.STRIP_STEREO_ABSOLUTE_GROUP: mol = strip_stereo_abs(mol) if options.STRIP_AND_GROUPS_ON_SINGLE_ATOM: mol = strip_stereo_and(mol) coordgen_enabled = options.GENERATE_COORDINATES in ( GenerateCoordinates.FULL, GenerateCoordinates.FULL_ALIGNED) # To be removed with LDIDEAS-5327; for now, force coordinate generation if # the property indicating this compound was sketched is present coordgen_enabled = getprop( mol.GetBoolProp, value=LD_PROP_FORCE_COORDGEN, default=coordgen_enabled) mol.ClearProp(LD_PROP_FORCE_COORDGEN) if coordgen_enabled: align = options.GENERATE_COORDINATES is GenerateCoordinates.FULL_ALIGNED mol = generate_coordinates(mol, align) mol = correct_sgroup_coordinates(mol) mol = clear_brackets_from_sgroups(mol) if options.CLEAN_WEDGE_ORIENTATION: # now that coordinates are set, we need to assign bond wedging mol = wedge_clean(mol) if options.EXPLICIT_HYDROGENS is ExplicitHydrogens.KEEP_WEDGED: # Make sure we remove all non-wedged H again. # SGroups have been updated, so reread them. sgroups = Chem.GetMolSubstanceGroups(mol) mol = remove_explicit_hydrogens(mol, sgroups, keep_wedged=True) if options.DOUBLE_BOND_STEREO_STANDARD is DoubleBondStereoStandard.CROSSED: mol = remove_wiggly_bonds_around_double_bonds(mol) mol = restore_attachment_points(mol) return mol
[docs]class BlindedCompoundError(ValueError): pass
[docs]def assert_not_blinded(mol: Chem.rdchem.Mol, max_num_atoms: Optional[int] = None): """ Checks imcoming mol to confirm it has real atoms; if it doesn't it may have been intentionally stripped by the caller. LiveDesign marks these structures as having been "blinded", meaning a customer may have IP/legal restrictions, or there's a delay in registering the structure despite having assay data available. Currently, LiveDesign handles these structures by keeping a row in the LiveReport, but without an associated SDF or image. This is different from other registration errors, which are simply archived. :param mol: RDKit Mol to consider :param max_mol_wt: maximum allowed molecular weight """ num_atoms = mol.GetNumAtoms() if num_atoms == 0: raise BlindedCompoundError("No atoms present") if all(atom.GetAtomicNum() == 0 for atom in mol.GetAtoms()): raise BlindedCompoundError("Only dummy atoms present") if max_num_atoms is not None and num_atoms > max_num_atoms: raise BlindedCompoundError( f"{num_atoms} atoms present; exceeds {max_num_atoms} atom limit")
[docs]def assert_not_query(mol: Chem.rdchem.Mol): """ Checks incoming mol to confirm there are no query features present on atoms or bonds, which would otherwise make it not compatible with registration. :param mol: RDKit Mol to consider """ for atom in mol.GetAtoms(): if atom.HasQuery(): if not is_queryatom_exception(atom): raise ValueError("Atom query feature found") if atom_has_non_standard_query(atom): raise ValueError("Non-standard atom query feature found") for bond in mol.GetBonds(): if bond.HasQuery(): raise ValueError("Bond query feature found") for s_group in Chem.GetMolSubstanceGroups(mol): if s_group_has_non_standard_query(s_group): raise ValueError("Non-standard s-group query feature found")
[docs]def get_atoms_mapping(mol_atoms): atom_idx_mapping = {} for at in mol_atoms: try: atom_idx_mapping[at.GetUnsignedProp( ATOM_PROP_ORIGINAL_INDEX)] = at.GetIdx() except KeyError: pass return atom_idx_mapping
[docs]def get_bonds_mapping(mol, original_bond_mapping, atom_idx_mapping): bond_idx_mapping = {} for bnd_idx, bnd_atom_old_idxs in original_bond_mapping.items(): try: bnd_atom_new_idxs = [ atom_idx_mapping[old_idx] for old_idx in bnd_atom_old_idxs ] except KeyError: # Any of the atoms does not exist continue new_bnd = mol.GetBondBetweenAtoms(*bnd_atom_new_idxs) if new_bnd is None: # The atoms exist, but are no longer bonded continue bond_idx_mapping[bnd_idx] = new_bnd.GetIdx() return bond_idx_mapping
[docs]def tag_mol_indexes(mol): """ Tag atoms with the initial indexes on the mol and create a bond mapping. Bonds are less stable than atoms, so we create an external mapping to the atoms they bind """ for atom in mol.GetAtoms(): atom.SetUnsignedProp(ATOM_PROP_ORIGINAL_INDEX, atom.GetIdx()) bond_mapping = { bnd.GetIdx(): (bnd.GetBeginAtomIdx(), bnd.GetEndAtomIdx()) for bnd in mol.GetBonds() } return bond_mapping
def _map_indexes(mapping, original_idxs): original_idxs = set(original_idxs) ret = set() for idx in original_idxs: try: new_idx = mapping[idx] except KeyError: pass else: ret.add(new_idx) return sorted(ret), original_idxs != ret
[docs]def check_attachment_points_changed(sg, atom_idx_mapping): for attachpt in sg.GetAttachPoints(): # if aIdx has been removed, then the SGroup doesn't make sense, # and we should drop it try: new_aIdx = atom_idx_mapping[attachpt.aIdx] except KeyError: raise ValueError('Attach point invalidated') else: if new_aIdx != attachpt.aIdx: return True # lvIdx might be a H atom we made implicit try: new_lvIdx = atom_idx_mapping[attachpt.lvIdx] except KeyError: return True else: if new_lvIdx != attachpt.lvIdx: return True return False
[docs]def check_cstate_changed(sg, bond_idx_mapping): for cstate in sg.GetCStates(): # Drop the SGroup if the CState bond has been removed. try: new_bond = bond_idx_mapping[cstate.bondIdx] except KeyError: raise ValueError('CState invalidated') else: if new_bond != cstate.bondIdx: return True return False
[docs]def get_updated_sgroup_indexes(sg, sg_atoms, sg_parent_atoms, sg_bonds, atom_idx_mapping, bond_idx_mapping): sg.SetAtoms(sg_atoms) sg.SetParentAtoms(sg_parent_atoms) sg.SetBonds(sg_bonds) attachpts = sg.GetAttachPoints() sg.ClearAttachPoints() for attachpt in attachpts: aIdx = atom_idx_mapping[attachpt.aIdx] # lvIdx might be a H atom we made implicit try: lvIdx = atom_idx_mapping[attachpt.lvIdx] except KeyError: lvIdx = 0 sg.AddAttachPoint(aIdx, lvIdx, attachpt.id) cstates = sg.GetCStates() sg.ClearCStates() for cstate in cstates: bond_idx = bond_idx_mapping[cstate.bondIdx] sg.AddCState(bond_idx, cstate.vector) return sg
[docs]def update_mol_groups(mol, stereo_groups, substance_groups, original_bond_mapping): """ Update atoms and bonds in stereo and substance groups, dropping any atoms/groups that are no longer valid for the current state of the mol. """ if not stereo_groups and not substance_groups: return mol atom_idx_mapping = get_atoms_mapping(mol.GetAtoms()) bond_idx_mapping = get_bonds_mapping(mol, original_bond_mapping, atom_idx_mapping) if stereo_groups: mol = update_stereo_groups(mol, stereo_groups, atom_idx_mapping) if substance_groups: mol = update_sgroups(mol, substance_groups, atom_idx_mapping, bond_idx_mapping) return mol
[docs]@audit_changes def update_sgroups(mol, substance_groups, atom_idx_mapping, bond_idx_mapping): """ Update SGroups to reflect the transformations done on mol, updating with new atom and bond indexes, as well as atoms that might have been added or removed. """ for sg in substance_groups: sg_atoms, atoms_changed = _map_indexes(atom_idx_mapping, sg.GetAtoms()) sg_parent_atoms, parent_atoms_changed = _map_indexes( atom_idx_mapping, sg.GetParentAtoms()) sg_bonds, bonds_changed = _map_indexes(bond_idx_mapping, sg.GetBonds()) try: attp_changed = check_attachment_points_changed(sg, atom_idx_mapping) cstate_changed = check_cstate_changed(sg, bond_idx_mapping) except ValueError: continue # If any of the lists changed, we need to update the SGroup if any((atoms_changed, parent_atoms_changed, bonds_changed, attp_changed, cstate_changed)): # If we removed everything that the SGroup contained, then drop it. if len(sg_atoms) == len(sg_parent_atoms) == len(sg_bonds) == 0: continue sg = get_updated_sgroup_indexes(sg, sg_atoms, sg_parent_atoms, sg_bonds, atom_idx_mapping, bond_idx_mapping) Chem.AddMolSubstanceGroup(mol, sg) return mol
[docs]@audit_changes def update_stereo_groups(mol, stereo_groups, atom_idx_mapping): rwmol = Chem.RWMol(mol) new_groups = [] for group in stereo_groups: old_indexes = [at.GetIdx() for at in group.GetAtoms()] new_indexes, _ = _map_indexes(atom_idx_mapping, old_indexes) if new_indexes: new_groups.append( Chem.CreateStereoGroup(group.GetGroupType(), rwmol, new_indexes)) rwmol.SetStereoGroups(new_groups) return rwmol.GetMol()
[docs]def handle_aromatic_heteroatoms_with_attachment_points(mol): """ Aromatic atoms with attachment points are impossible to kekulize, clear that up here by making it explicit that they have an implicit H attached (This was SS-31328) """ res = Chem.Mol(mol) for atom in res.GetAtoms(): if (atom.GetIsAromatic() and atom.GetAtomicNum() != 6 and atom.HasProp(MOL_PROP_ATTACHPT)): atom.SetNumExplicitHs(1) atom.SetNoImplicit(True) return res
[docs]@audit_changes def fix_pentavalent_aromatic_nitrogens(mol): """ Aromatic pentavalent nitrogens cannot be kekulized. This needs to happen before we check/fix kekulization, which needs to happen before the tautomer-chooser. The _other_ transforms need to happen after the tautomer-chooser, so this can't be a "standard transform". """ return transform(mol, "[n+0;v5:1]=[#8+0:2]>>[+:1]-[#8-:2]")
[docs]@audit_changes def add_explicit_hydrogens(mol): return rdmolops.AddHs(mol, explicitOnly=False, addCoords=True)
[docs]@audit_changes def remove_explicit_hydrogens(mol, sgroups, keep_wedged=False): # we use this to flag Hs that should not be removed. # there's no reasonable scenario in which an H atom # in a molecule could have an isotope value of 10, so # this should be safe save_isotope = 10 ps = Chem.RemoveHsParameters() ps.removeWithWedgedBond = not keep_wedged # since we likely do not have information about wedging still on the bonds, the above check # may not save us. Let's explicitly protect Hs at the end of wedged bonds from # being removed: saved_hs = False if keep_wedged: for atom in mol.GetAtoms(): if atom.GetAtomicNum() == 1 and atom.GetIsotope() == 0: for bnd in atom.GetBonds(): # why this is as complex as it is: # Information about bond wedging is stored as a bond property after the CTAB # is parsed. Because the values have different meanings, the V2000 and V3000 # parsers use different property names. # The values here correspond to bonds which are wedged, hashed, or "squiggled" # above comment valid for at least the 2020.03 RDKit release if getprop(bnd.GetUnsignedProp, BOND_PROP_BOND_STEREO) in (1, 6, 4) or \ getprop(bnd.GetUnsignedProp,BOND_PROP_BOND_CONFIG) in (1, 2, 3): atom.SetIsotope(save_isotope) saved_hs = True break # hydrogens that are an in an XBOND in a polymer sgroup should not be # removed, or else RDKit will remove the entire sgroup for sgroup in sgroups: if not is_polymer(sgroup): continue for bnd_idx in sgroup.GetBonds(): bnd = mol.GetBondWithIdx(bnd_idx) for atom in [bnd.GetBeginAtom(), bnd.GetEndAtom()]: if atom.GetAtomicNum() == 1 and atom.GetIsotope() == 0: atom.SetIsotope(save_isotope) saved_hs = True ps.updateExplicitCount = True res = rdmolops.RemoveHs(mol, ps, sanitize=False) if saved_hs: for atom in res.GetAtoms(): if atom.GetAtomicNum() == 1 and atom.GetIsotope() == save_isotope: atom.SetIsotope(0) return res
[docs]def is_polymer(s_group): if not s_group.HasProp("TYPE"): raise ValueError( f"Substance group {s_group.GetIndexInMol()} does not have the TYPE property" ) return s_group.GetProp("TYPE") in { "SRU", "MON", "COP", "CRO", "GRA", "MOD", "MER", "ANY" }
[docs]def convert_to_molblock(mol, options=None): """ Convert processed mol into a molblock and make necessary updates. """ options = options or PreprocessorOptions() kekulize = options.RING_REPRESENTATION is RingRepresentation.KEKULE processed_molblock = Chem.SDWriter.GetText( mol, kekulize=kekulize, force_v3000=True) if options.HEAVY_HYDROGEN_DT: processed_molblock = convert_heavy_hydrogens(processed_molblock) # do this at the very end because we need the mol block and the molecule processed_molblock = set_double_bond_stereo( processed_molblock, mol, options.DOUBLE_BOND_STEREO_STANDARD) return processed_molblock
[docs]@audit_changes def convert_heavy_hydrogens(molblock): """ NOTE that this operates on a molblock, not a molecule The RDKit does not currently (v2020.03) support writing D or T to mol blocks, so we need to post-process the text. Fortunately it's an easy regex in v3000 mol blocks. This does not work with V2000 mol blocks, so we throw a ValueError there. This doesn't seem like a big deal since V2000 support is primarly being kept around for debugging purposes. If we need to eventually support V2000+HEAVY_HYDROGEN_DT, some not-completely-trivial code will need to be written. """ d_expr = re.compile( r"^(M V30 [0-9]+) H (.+?) MASS=2([^\n]*)", flags=re.MULTILINE) out_molblock = d_expr.sub(r"\1 D \2\3", molblock) t_expr = re.compile( r"^(M V30 [0-9]+) H (.+?) MASS=3([^\n]*)", flags=re.MULTILINE) out_molblock = t_expr.sub(r"\1 T \2\3", out_molblock) return out_molblock
[docs]@audit_changes def neutralize(mol, checkForProblematicHs=False): res = uncharger.uncharge(mol) res.UpdatePropertyCache(strict=False) if checkForProblematicHs: # NOTE the logic here really only applies to the organic subset. # it's not going to do well with other element types, but hopefully # no-one is doing neutralization on species with non-organic atoms # and EXPLICIT_HS set to "AS_IS" if res.GetNumAtoms() != mol.GetNumAtoms(): raise RuntimeError("uncharging changed the number of atoms") for i in range(res.GetNumAtoms()): oAt = mol.GetAtomWithIdx(i) oChg = oAt.GetFormalCharge() if oChg > 0: nAt = res.GetAtomWithIdx(i) nChg = nAt.GetFormalCharge() if nChg != oChg: # positive charges on atoms with Hs should have had an H removed, but # we can't currently do that if oAt.GetTotalNumHs( includeNeighbors=True) - oAt.GetTotalNumHs(): raise ValueError( "could not neutralize positive charged atom with explicit H neighbors" ) return res
[docs]def unicode_to_str(unicode_str): """ Takes a unicode object and converts it to a str (utf-8). If the arg is already a str, returns unicode_str (i.e. if run with python 3). Needed to support python 2/3 with unicode_literals. py2: type<unicode> -> type<str utf-8> py3: type<str utf-8> (no unicode type exists) :type unicode_str: unicode (py2) or str (py3) :param unicode_str: the unicode that potentially needs converting (i.e. if run with python 2) :return: str """ if isinstance(unicode_str, str): return unicode_str return unicode_str.encode("utf-8")
[docs]@audit_changes def transform(mol, transformation): """ apply the transformation to the molecule repeatedly until it no longer applies. the maxTransformations argument is just there to prevent us from ending up in an infinite loop due to a bogus transformation Please note that running transformations may alter the stereochemistry of mol, so a stereo recalculation from coordinates might be required. """ max_transformations = 1000 smarts = unicode_to_str(transformation) rxn = rdChemReactions.ReactionFromSmarts(smarts) for _ in range(max_transformations): output = rxn.RunReactants((mol,)) if output: mol = output[0][0] mol.UpdatePropertyCache(strict=False) else: # When we get here, the reaction can no longer be applied # on whatever mol is at that moment, so don't try again break return mol
[docs]def in_xy_plane(mol): if mol.GetNumConformers() == 0: return False return all(xyz[2] == 0 for xyz in mol.GetConformer().GetPositions())
[docs]@audit_changes def generate_coordinates(mol, align=False): if mol.GetNumAtoms() < 2: # we don't really need to deal with coordgen if there's only a single atom mol.RemoveAllConformers() conf = Chem.Conformer(mol.GetNumAtoms()) conf.Set3D(False) mol.AddConformer(conf) return mol # keep original mol to align with original_mol = Chem.Mol(mol) Chem.rdCoordGen.AddCoords(mol) # align input mol and mol with new coords if align and in_xy_plane(mol) and in_xy_plane(original_mol): rdMolAlign.AlignMol(mol, original_mol) logger.debug("GENERATE_COORDINATES") return mol
def _find_matches(mol, st): """Which atoms match?""" # it's possible that atoms were added or deleted. We hope that this is only # hydrogens rdk_non_hydrogens = sum(1 for a in mol.GetAtoms() if a.GetAtomicNum() != 1) schro_non_hydrogens = sum(1 for a in st.atom if a.atomic_number != 1) if rdk_non_hydrogens != schro_non_hydrogens: msg = (f"Schrodinger structure doesn't match RDKit mol, they have " f"different numbers of non-hydrogen atoms (RDKit: " f"{rdk_non_hydrogens} != Schrodinger: {schro_non_hydrogens})") raise rdkit_adapter.InconsistentStructureError(msg) matches = {} for a in st.atom: try: idx = a.property[adapter.RDK_INDEX] except KeyError: continue rdkit_atom = mol.GetAtomWithIdx(idx) if rdkit_atom: matches[a] = rdkit_atom return matches _BOND_TYPES_S2R = { structure.BondType.Single: Chem.BondType.SINGLE, structure.BondType.Double: Chem.BondType.DOUBLE, structure.BondType.Triple: Chem.BondType.TRIPLE, structure.BondType.Zero: Chem.BondType.ZERO, structure.BondType.Dative: Chem.BondType.DATIVE }
[docs]def copy_lewis_structure_and_hydrogens(st, mol, kekulize=True): """ Applies bond orders and charges from st to mol. Updates #implicitH to match Assumes st includes all hydrogens. Adds implicit and explicit hydrogens to the mol, but does not add any graph hydrogens. May remove graph hydrogens. """ editmol = Chem.RWMol(mol) matches = _find_matches(editmol, st) # Adjust bond orders, retaining aromicity if requested for bond in st.bond: a1, a2 = bond.atom1, bond.atom2 rdk_a1 = matches.get(a1) rdk_a2 = matches.get(a2) if not rdk_a1 or not rdk_a2: continue rdbond = editmol.GetBondBetweenAtoms(rdk_a1.GetIdx(), rdk_a2.GetIdx()) new_type = _BOND_TYPES_S2R[bond.type] if new_type != rdbond.GetBondType(): rdbond.SetBondType(new_type) # Adjust charges - assumes that the mmct charge is good. for mmct_atom, rdkit_atom in matches.items(): charge = mmct_atom.formal_charge if charge != rdkit_atom.GetFormalCharge(): rdkit_atom.SetFormalCharge(charge) Chem.SanitizeMol(editmol, sanitizeOps=Chem.SANITIZE_ADJUSTHS) graph_hydrogens_to_delete = [] for mmct_atom, rdkit_atom in matches.items(): mmct_hydrogens = sum( (1 for a in mmct_atom.bonded_atoms if a.atomic_number == 1)) mmct_hydrogens += mm.mmat_get_nhua(mmct_atom.atom_type) # hydrogen count is implicit + explicit (shown in smiles) + graph hydrogens rdk_hydrogens = rdkit_atom.GetTotalNumHs(includeNeighbors=True) # A hydrogen was added or removed on the Schrodinger side if rdk_hydrogens != mmct_hydrogens: new_explicit_h_count = rdkit_atom.GetNumExplicitHs( ) + mmct_hydrogens - rdk_hydrogens if new_explicit_h_count >= 0: rdkit_atom.SetNumExplicitHs(new_explicit_h_count) else: # Need to delete graph hydrogens hydrogens = [ a.GetIdx() for a in rdkit_atom.GetNeighbors() if a.GetAtomicNum() == 1 ] remove_count = rdk_hydrogens - mmct_hydrogens assert len(hydrogens) >= remove_count for h_index in hydrogens[:remove_count]: graph_hydrogens_to_delete.append(h_index) graph_hydrogens_to_delete.sort(reverse=True) for atom in graph_hydrogens_to_delete: editmol.RemoveAtom(atom) Chem.SanitizeMol(editmol, sanitizeOps=_SANITIZE_OPS) mol = editmol.GetMol() mol.UpdatePropertyCache(strict=False) return mol
[docs]@audit_changes def generate_canonical_tautomer(mol): st = rdkit_adapter.from_rdkit( mol, include_properties=False, include_stereo=False) st = epik_tautomer_canonicalizer.TautomerCanonicalizer().apply(st)[0] return copy_lewis_structure_and_hydrogens(st, mol)
[docs]@audit_changes def clear_wedge_bonds_from_achiral_centers(mol): modified = False new_mol = Chem.Mol(mol) Chem.AssignStereochemistry(new_mol, cleanIt=True, force=True) for orig_at, new_at in zip(mol.GetAtoms(), new_mol.GetAtoms()): if orig_at.GetChiralTag() != new_at.GetChiralTag(): modified = True break if not modified: for orig_bnd, new_bnd in zip(mol.GetBonds(), new_mol.GetBonds()): if (orig_bnd.GetStereo() != new_bnd.GetStereo() or orig_bnd.GetBondDir() != new_bnd.GetBondDir()): modified = True break return new_mol
[docs]@audit_changes def calculate_enhanced_stereo(mol, enh_stereo_default_grouping, initial_chiral_flag): # We decided to always set the chiral flag on preprocessed mols mol.SetUnsignedProp(MOL_PROP_CHIRAL_FLAG, MOL_PROP_ON) if len(mol.GetStereoGroups()) != 0: return mol chiral_atoms = [ at.GetIdx() for at in mol.GetAtoms() if at.GetChiralTag() in (Chem.ChiralType.CHI_TETRAHEDRAL_CCW, Chem.ChiralType.CHI_TETRAHEDRAL_CW) ] if len(chiral_atoms) == 0: return mol if initial_chiral_flag == MOL_PROP_ON or enh_stereo_default_grouping == ChiralFlag0Meaning.UNGROUPED_ARE_ABSOLUTE: group_type = Chem.StereoGroupType.STEREO_ABSOLUTE elif enh_stereo_default_grouping == ChiralFlag0Meaning.UNGROUPED_ARE_RACEMIC: group_type = Chem.StereoGroupType.STEREO_AND else: group_type = Chem.StereoGroupType.STEREO_OR rwmol = Chem.RWMol(mol) stereo_group = Chem.CreateStereoGroup(group_type, rwmol, chiral_atoms) rwmol.SetStereoGroups([stereo_group]) return rwmol.GetMol()
[docs]@audit_changes def strip_stereo_abs(input_mol): """ Removes any Stereo ABS group :param input_mol: The original molecule to consider :return: post-processed molecule, if the input molecule was modified """ mol = Chem.RWMol(input_mol) keep = [] for stereo_group in mol.GetStereoGroups(): if stereo_group.GetGroupType() != Chem.StereoGroupType.STEREO_ABSOLUTE: keep.append(stereo_group) mol.SetStereoGroups(keep) return Chem.Mol(mol)
[docs]@audit_changes def strip_stereo_and(input_mol): """ Removes any Stereo AND groups with only one center and flattens the bonds around it :param input_mol: The original molecule to consider :return: post-processed molecule, if the input molecule was modified """ mol = Chem.RWMol(input_mol) keep = [] for stereo_group in mol.GetStereoGroups(): if stereo_group.GetGroupType() != Chem.StereoGroupType.STEREO_AND: keep.append(stereo_group) elif len(stereo_group.GetAtoms()) > 1: keep.append(stereo_group) else: # flatten the atom, At this point the stereo_group only has one atom atom = stereo_group.GetAtoms()[0] atom.SetChiralTag(Chem.ChiralType.CHI_UNSPECIFIED) # make sure that all bond wedging information has been removed around that atom too: for bond in atom.GetBonds(): if bond.GetBeginAtomIdx() == atom.GetIdx(): bond.ClearProp(BOND_PROP_BOND_STEREO ) # what we'd get from a V2000 mol file bond.ClearProp(BOND_PROP_BOND_CONFIG ) # what we'd get from a V3000 mol file mol.SetStereoGroups(keep) return Chem.Mol(mol)
[docs]def frag_is_smaller(atoms, largest_atoms, weight, largest_weight, smiles, largest_smiles): """ A fragment is considered larger if its atoms/weight are larger, the length of the smiles string is larger, or the smiles string is lexicographically *smaller* if they are equal length. ie, 'AAA' is larger than 'AAB'.. hence the final smiles > largest_smiles check here to reject """ if atoms < largest_atoms: return True if atoms > largest_atoms: return False if weight < largest_weight: return True if weight > largest_weight: return False if len(smiles) < len(largest_smiles): return True if len(smiles) > len(largest_smiles): return False return smiles > largest_smiles
[docs]def connect_variable_attachment_points(mol): """ forms zero-order bonds between one of the atoms of a bond with an ATTACH property to the "main" molecule in order to have the molecule+variable attachment point treated as a single fragment returns a 2-tuple with: 1. the modified molecule 2. whether or not the molecule was modified """ bonds_added = False res = None for bond in list(mol.GetBonds()): if bond.HasProp("_MolFileBondAttach") and bond.HasProp( "_MolFileBondEndPts"): # these should look like: ENDPTS=(3 4 6 5) endp_txt = bond.GetProp("_MolFileBondEndPts") # do a bit of validation that the format is correct: if endp_txt[0] != "(" or endp_txt[-1] != ")": logger.warning("invalid ENDPTS format ignored") continue endps = [int(x) for x in endp_txt[1:-1].split(" ")] # do a bit of validation that the format is correct: if len(endps) != endps[0] + 1 or endps[0] == 1: logger.warning("invalid ENDPTS format ignored") continue batom_idx = bond.GetBeginAtomIdx() oatom_idx = endps[1] - 1 if res is None: res = Chem.RWMol(mol) if res.GetBondBetweenAtoms(batom_idx, oatom_idx): logger.warning("variable attachment point already connected") continue res.AddBond(batom_idx, oatom_idx, Chem.BondType.ZERO) # set a property on the bond so that we can find it again: res.GetBondBetweenAtoms(batom_idx, oatom_idx).SetIntProp( "variable_attach_bond", 1) bonds_added = True if res is None: res = mol return res, bonds_added
[docs]@audit_changes def remove_fragments(mol, substance_groups): """ Fragments are not removed if the molecule contains any SGroups which are associated with polymers Use the following criteria to remove unwanted fragments from *mol*: 1. keep only the fragment which has the most number of atoms 2. break ties by keeping only fragments with the greatest molecular weight 3. break ties with the longest smiles string 4. break additional ties by keeping the fragment with the earliest alpha sorted SMILES string If two or more identical fragments remain after 1-4, we will throw a fatal error. """ for sg in substance_groups: if getprop(sg.GetProp, "TYPE") in ( "MUL", "SRU", "MON", "COP", "CRO", "GRA", "MIX", "FOR", "MOD", ): logger.debug( "Molecule has polymeric SGroups, skipping remove_fragments.") return mol nmol, bonds_added = connect_variable_attachment_points(mol) frags = Chem.GetMolFrags(nmol, asMols=True, sanitizeFrags=False) if len(frags) < 2: return mol largest_frag = None largest_atoms = math.inf largest_weight = math.inf largest_smiles = None duplicates = 0 for frag in frags: [atoms, weight, smiles] = [ frag.GetNumHeavyAtoms(), MolWt(frag), Chem.MolToSmiles(frag), ] if largest_frag is not None: if frag_is_smaller(atoms, largest_atoms, weight, largest_weight, smiles, largest_smiles): continue # If all properties are equivalent, we have a *potential* duplicate of the largest known fragment # but if they are not, we've discovered a new, bigger fragment, and may discard any known dupes if (atoms == largest_atoms and weight == largest_weight and smiles == largest_smiles): duplicates += 1 else: duplicates = 0 largest_frag = frag largest_atoms = atoms largest_weight = weight largest_smiles = smiles else: largest_frag = frag largest_atoms = atoms largest_weight = weight largest_smiles = smiles if duplicates: message = ( "At the end of REMOVE_FRAGMENTS, we had {duplicates} identical " "fragments left over, returning only one.") logger.debug(message.format(duplicates=duplicates)) if bonds_added: largest_frag = Chem.RWMol(largest_frag) bnds = list(largest_frag.GetBonds()) for bnd in bnds: if bnd.HasProp("variable_attach_bond"): largest_frag.RemoveBond(bnd.GetBeginAtomIdx(), bnd.GetEndAtomIdx()) largest_frag = largest_frag.GetMol() return largest_frag
[docs]@audit_changes def clear_brackets_from_sgroups(mol): """ Removes brackets from any s-groups """ sgs = Chem.GetMolSubstanceGroups(mol) Chem.ClearMolSubstanceGroups(mol) for sg in sgs: sg.ClearBrackets() Chem.AddMolSubstanceGroup(mol, sg) return mol
[docs]@audit_changes def remove_properties(mol): for prop_name in mol.GetPropNames(): mol.ClearProp(prop_name) return mol
[docs]def filter_sgroups(mol, which): substance_groups = Chem.GetMolSubstanceGroups(mol) Chem.ClearMolSubstanceGroups(mol) if which is RemoveSGroupData.NONE: return substance_groups elif which is RemoveSGroupData.ALL: return [] elif which is RemoveSGroupData.DAT_ONLY: return [sg for sg in substance_groups if sg.GetProp("TYPE") != "DAT"] # we shouldn't get here raise ValueError('Unknwon SGroup filtering mode')
[docs]@audit_changes def strip_salts(mol, salt_list): salt_list_str = "\n".join(salt_list) remover = SaltRemover.SaltRemover(defnData=salt_list_str) res = remover.StripMol(mol) if res.GetNumAtoms() == 0: raise ValueError("Removing salts produced an empty structure") return res
[docs]def apply_transformations(mol, transformations): """ Apply the given list of transformations, and recalculate stereo if at least one transformation applies. """ for tform in transformations: mol = transform(mol, tform) Chem.SanitizeMol(mol, sanitizeOps=_SANITIZE_OPS) # If any reactions applied, we need to rescan stereo from coordinates # because bond orders & stereo bonds might have changed assign_stereochemistry(mol) return mol
[docs]@audit_changes def add_chiral_hs(mol): # need to filter chiral_atoms to get only atoms with endocyclic stereobonds # since we don't want to add hydrogens to chiral atoms that already have # exocyclic stereobonds chiral_atoms = [center[0] for center in Chem.FindMolChiralCenters(mol)] chiral_atoms_needing_hydrogens = [] for atom_idx in chiral_atoms: atom = mol.GetAtomWithIdx(atom_idx) # only mark this for adding hydrogens if there are no exocyclic bonds add_atom = all(bond.IsInRing() for bond in atom.GetBonds()) if add_atom: chiral_atoms_needing_hydrogens.append(atom_idx) # return mol if there are no chiral atoms to be adjusted if not chiral_atoms_needing_hydrogens: return mol return Chem.AddHs( mol, explicitOnly=False, addCoords=True, onlyOnAtoms=chiral_atoms_needing_hydrogens, )
[docs]@audit_changes def wedge_clean(mol): if not mol.GetNumConformers(): return mol # resetting the BondDir and UnknownStereo setting on each bond # so WedgeMolBonds can do its magic for bond in mol.GetBonds(): if bond.GetBondType() == Chem.BondType.SINGLE and bond.IsInRing(): if bond.GetBondDir() == Chem.BondDir.UNKNOWN: bond.SetIntProp(MOL_PROP_UNKNOWN_STEREO, MOL_PROP_ON) bond.SetBondDir(Chem.BondDir.NONE) # bonds which were explicitly marked as unknown: if getprop(bond.GetUnsignedProp, BOND_PROP_BOND_STEREO) == 4 or \ getprop(bond.GetUnsignedProp, BOND_PROP_BOND_CONFIG) == 2: # ensure that the bond doesn't start at an atom with an specified double # bond disqualify = False for obond in bond.GetBeginAtom().GetBonds(): if (obond.GetBondType() == Chem.BondType.DOUBLE and obond.GetStereo() != Chem.BondStereo.STEREONONE): disqualify = True break if not disqualify: bond.SetBondDir(Chem.BondDir.UNKNOWN) Chem.WedgeMolBonds(mol, mol.GetConformer()) return mol
[docs]@audit_changes def reapply_molblock_wedging(mol): for bnd in mol.GetBonds(): # only change the wedging if the bond was wedged in the input data (we # recognize that by looking for the properties the mol file parser # sets): if bnd.HasProp(BOND_PROP_BOND_STEREO): # V2000 val = bnd.GetProp(BOND_PROP_BOND_STEREO) if val == "1": bnd.SetBondDir(Chem.BondDir.BEGINWEDGE) elif val == "6": bnd.SetBondDir(Chem.BondDir.BEGINDASH) elif val == "4": bnd.SetBondDir(Chem.BondDir.UNKNOWN) elif bnd.HasProp(BOND_PROP_BOND_CONFIG): # V3000 val = bnd.GetProp(BOND_PROP_BOND_CONFIG) if val == "1": bnd.SetBondDir(Chem.BondDir.BEGINWEDGE) elif val == "3": bnd.SetBondDir(Chem.BondDir.BEGINDASH) elif val == "2": bnd.SetBondDir(Chem.BondDir.UNKNOWN) elif bnd.GetBondDir() in (Chem.BondDir.BEGINDASH, Chem.BondDir.BEGINWEDGE, Chem.BondDir.UNKNOWN): bnd.SetBondDir(Chem.BondDir.NONE) return mol
[docs]@audit_changes def remove_wiggly_bonds_around_double_bonds(mol): # We just need to make sure that there any wiggly bonds starting at atoms # involved in double bonds don't end up in the output for bond in mol.GetBonds(): if bond.GetBondType() == Chem.BondType.SINGLE and ( getprop(bond.GetUnsignedProp, BOND_PROP_BOND_STEREO) == 4 or getprop(bond.GetUnsignedProp, BOND_PROP_BOND_CONFIG) == 2): # it's a wiggly bond. Check to see if it starts at an atom with a double bond startsAtDouble = False for obond in bond.GetBeginAtom().GetBonds(): if (obond.GetBondType() == Chem.BondType.DOUBLE and obond.GetStereo() != Chem.BondStereo.STEREONONE): startsAtDouble = True break if startsAtDouble: if bond.HasProp(BOND_PROP_BOND_STEREO): bond.ClearProp(BOND_PROP_BOND_STEREO) if bond.HasProp(BOND_PROP_BOND_CONFIG): bond.ClearProp(BOND_PROP_BOND_CONFIG) bond.SetBondDir(Chem.BondDir.NONE) return mol
[docs]@audit_changes def set_double_bond_stereo(mol_block, mol, bond_type): # as of the 2020.03 release cycle the RDKit will always write double bonds with # unknown stereochemistry as crossed bonds. This is done at the C++ level and # can't be modified from Python. We work around that here by doing regex changes # in the output mol_block. # some notes on this: # - This is a problem which would ideally be solved in the core RDKit, with a # real implementation connected directly to the generation of mol blocks. # Until that's there we're kind of stuck with this hacky (though hopefully correct) # solution. # - It is, unsurprisingly, fragile. It's quite easy to construct examples # where a double bond has more than one wiggly bond to it. This is ugly, # but not wrong. # Explanation of the constants being used, this is taken from the Biovia CTAB documentation: # http://help.accelrysonline.com/ulm/onelab/1.0/content/ulm_pdfs/direct/reference/ctfileformats2016.pdf # # Marking a double bond as CROSSED to indicate unknown stereochemistry is done # by setting CFG=2 on the double bond in V3000 # the RDKit parses this field into the property "_MolFileBondCfg" # in V2000 it's by setting 3 in the "bond stereo" field # the RDKit parses this field into the property "_MolFileBondStereo" # # Marking a single bond as wiggly to indicate unknown stereochemistry on a neighboring # double bond or chiral center is done by setting CFG=2 on the single bond in V3000 # the RDKit parses this field into the property "_MolFileBondCfg" # in V2000 it's by setting 4 in the "bond stereo" field # the RDKit parses this field into the property "_MolFileBondStereo" out_mol_block = mol_block if bond_type is DoubleBondStereoStandard.CROSSED: # this is what the RDKit does by default. pass elif bond_type is DoubleBondStereoStandard.WIGGLY: # we need to create one wiggly bond per double bond. Do the one that is shared # with the least number of other double bonds # start by identifying bonds next to double bonds that have stereo specified: next_to_specified_double_bond = [0] * mol.GetNumBonds() for bond in mol.GetBonds(): if bond.GetBondType() == Chem.BondType.DOUBLE and bond.GetStereo( ) not in ( Chem.rdchem.BondStereo.STEREOANY, Chem.rdchem.BondStereo.STEREONONE, ): # mark all of our neighbors: begin_atom = bond.GetBeginAtom() end_atom = bond.GetEndAtom() for contiguous_bond in begin_atom.GetBonds( ) + end_atom.GetBonds(): next_to_specified_double_bond[contiguous_bond.GetIdx()] = 1 single_bond_scores = [0] * mol.GetNumBonds() unknown_double_bond_nbrs = defaultdict(list) for bond in mol.GetBonds(): if (bond.GetBondType() == Chem.BondType.DOUBLE and bond.GetStereo() == Chem.rdchem.BondStereo.STEREOANY): # increment the counts of our eligible neighbors: begin_atom = bond.GetBeginAtom() end_atom = bond.GetEndAtom() for contiguous_bond in begin_atom.GetBonds( ) + end_atom.GetBonds(): if (not next_to_specified_double_bond[contiguous_bond. GetIdx()] and contiguous_bond.GetBondType() == Chem.BondType.SINGLE and contiguous_bond.GetBondDir() == Chem.BondDir.NONE): single_bond_scores[contiguous_bond.GetIdx()] += 1 unknown_double_bond_nbrs[bond.GetIdx()].append( contiguous_bond.GetIdx()) for dbl_bnd_idx in unknown_double_bond_nbrs: nbr_scores = sorted( [(single_bond_scores[x], x) for x in unknown_double_bond_nbrs[dbl_bnd_idx]]) if not nbr_scores: logger.warning( f"cannot find a single bond to mark as WIGGLY for double bond {bond.GetIdx()+1}" ) continue single_bond_to_mark = nbr_scores[0][-1] # now we know which double bond and which single bond we need to change. # go ahead and change them in the mol block # we replace the crossed double bond, which looks like this: # M V30 3 2 1 2 CFG=2 # with its uncrossed form: # M V30 3 2 1 2 # and we make the single bond wiggly, which is converting it from this: # M V30 3 1 1 3 # to this: # M V30 3 1 1 3 CFG=2 # first do the double bond: out_mol_block = re.sub( r"(M V30 %d 2 [0-9]+ [0-9]+) CFG=2" % (dbl_bnd_idx + 1), r"\1", out_mol_block, ) # now the single bond out_mol_block = re.sub( r"(M V30 %d 1 [0-9]+ [0-9]+)" % (single_bond_to_mark + 1), r"\1 CFG=2", out_mol_block, ) elif bond_type is DoubleBondStereoStandard.NONE: # go back to whatever we had before for bond in mol.GetBonds(): if (bond.GetBondType() == Chem.BondType.DOUBLE and bond.GetStereo() == Chem.rdchem.BondStereo.STEREOANY): # V3000 crossed bond cfg = 0 if bond.HasProp(BOND_PROP_BOND_CONFIG): cfg = bond.GetUnsignedProp(BOND_PROP_BOND_CONFIG) elif bond.HasProp(BOND_PROP_BOND_STEREO): cfg = bond.GetUnsignedProp(BOND_PROP_BOND_STEREO) # translate v2000->v3000 if cfg == 3: cfg = 2 else: cfg = 0 if cfg == 2: # it was originally crossed, it will still be crossed, no need to do anything pass else: reset_dbl_bond = False # and find neighboring wiggly single bonds begin_atom = bond.GetBeginAtom() end_atom = bond.GetEndAtom() for contiguous_bond in begin_atom.GetBonds( ) + end_atom.GetBonds(): if (contiguous_bond == bond or contiguous_bond.GetBondType() != Chem.BondType.SINGLE): continue cfg = 0 if contiguous_bond.HasProp(BOND_PROP_BOND_CONFIG): cfg = contiguous_bond.GetUnsignedProp( BOND_PROP_BOND_CONFIG) elif contiguous_bond.HasProp(BOND_PROP_BOND_STEREO): cfg = contiguous_bond.GetUnsignedProp( BOND_PROP_BOND_STEREO) # translate v2000->v3000 if cfg == 4: cfg = 2 else: cfg = 0 if cfg: bnd_idx = contiguous_bond.GetIdx() if (re.search( r"M V30 %d 1 [0-9]+ [0-9]+ CFG=" % (bnd_idx + 1), mol_block, ) is None): out_mol_block = re.sub( r"(M V30 %d 1 [0-9]+ [0-9]+)" % (bnd_idx + 1), r"\1 CFG=2", out_mol_block, ) reset_dbl_bond = True else: # if we somehow already ended up with a configuration (perhaps because of wedging elsewhere) # generate a warning, but don't mess with it: logger.warning( f"unable to set single bond {bnd_idx+1} to be a wiggly bond." ) if reset_dbl_bond: # uncross the double bond: dbl_bnd_idx = bond.GetIdx() out_mol_block = re.sub( r"(M V30 %d 2 [0-9]+ [0-9]+) CFG=2" % (dbl_bnd_idx + 1), r"\1", out_mol_block, ) else: logger.warning( f"unable to write double bond {bond.GetIdx()+1} without a crossed bond." ) else: raise ValueError( f"Unrecognized value for DOUBLE_BOND_STEREO_STANDARD {bond_type}") return out_mol_block
[docs]def get_audit_log(in_mol: Chem.rdchem.Mol, out_mol: Chem.rdchem.Mol) -> dict: """ Build an audit log for the input/output Mols, which takes advantage of a global list of modifications performed during preprocessing. """ audit_log = {} audit_log["molfile_info"] = in_mol.GetProp("_MolFileInfo").strip() audit_log["input_structure"] = Chem.MolToCXSmiles(in_mol) audit_log["modifications"] = audit_changes_log or "UNAVAILABLE" audit_log["output_structure"] = Chem.MolToCXSmiles(out_mol) audit_log["hash_layers"] = molhash.get_mol_layers(out_mol)._asdict() return audit_log
[docs]@main_wrapper("LiveDesign Structure Preprocessor") def main(argv=None): """ Function to run preprocessor directly from the command line. """ global audit_changes_log full_audit_log = [] parser = argparse.ArgumentParser( description="Run the preprocessor on an SD file") parser.add_argument("input", help="input SDF") parser.add_argument("-output", default="out.sdf", help="output SDF") parser.add_argument("-config", help="JSON config file") parser.add_argument("-verbose", action="store_true", help="Verbose logging") args = parser.parse_args(argv) logger.setLevel(log.logging.DEBUG if args.verbose else log.logging.INFO) options = None if args.config: with open(args.config) as fh: config_json = json.load(fh) options = PreprocessorOptions.fromConfig(config_json) logger.debug(f"Preprocesor Configuration: {config_json}") with infrastructure.TextBlockReader(args.input) as reader, \ infrastructure.TextBlockWriter(args.output) as writer: for in_txt in reader: in_txt = in_txt.decode() audit_changes_log = [] if args.verbose else None try: in_mol = convert.sdf_to_rdkit(in_txt) out_mol = preprocess(in_mol, options) out_txt = convert_to_molblock(out_mol, options) writer.append(out_txt.encode()) except Exception as exc: logger.info(f"Failed to process structure:\n{in_txt}") logger.info(f"Modifications: {audit_changes_log}\n") logger.exception(f"{exc}") logger.info(log.SINGLE_LINE) continue if args.verbose: full_audit_log.append(get_audit_log(in_mol, out_mol)) if args.verbose and full_audit_log: logger.debug(json.dumps(full_audit_log, indent=4))
[docs]@audit_changes def handle_v2000_coordinate_bonds(mol): """ Turn v2000 MRV COORDINATE Query Bonds into real Coordinate Bonds, and drop the data SGroups COORDINATE property. Just setting the bond type is not enough, since these bonds are Chem.QueryBond instead of Chem.Bond and will fail the compatibilty check. """ sgs = Chem.GetMolSubstanceGroups(mol) if len(sgs) == 0: return mol coordinate_bonds = [] Chem.ClearMolSubstanceGroups(mol) for sg in sgs: if getprop(sg.GetProp, 'TYPE') == 'DAT' and getprop( sg.GetProp, 'FIELDNAME') == 'MRV_COORDINATE_BOND_TYPE': # Docs at https://docs.chemaxon.com/display/docs/chemaxon-specific-information-in-mdl-mol-files.md # say that the data in these SGroups is an "index" (not "indexes"), # so we assume there's one SGroup for each coordinate bond. sg_atoms = sg.GetAtoms() assert len(sg_atoms) == 2 bnd = mol.GetBondBetweenAtoms(*sg_atoms) coordinate_bonds.append(bnd.GetIdx()) else: Chem.AddMolSubstanceGroup(mol, sg) if coordinate_bonds: tmp_mol = Chem.MolFromSmiles('CC') tmp_bnd = tmp_mol.GetBondWithIdx(0) tmp_bnd.SetBondType(Chem.BondType.DATIVE) rwmol = Chem.RWMol(mol) for bnd in coordinate_bonds: # ReplaceBond makes copies, so we can reuse tmp_bnd rwmol.ReplaceBond(bnd, tmp_bnd, preserveProps=True) mol = rwmol.GetMol() return mol
if __name__ == "__main__": main()